C18H32Cl3N3 — CID 22252291
N-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)butyl]aniline;trihydrochloride (PubChem CID 22252291) has the molecular formula C18H32Cl3N3 and a molecular weight of 396.83 g/mol. Its IUPAC name is N-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)butyl]aniline;trihydrochloride.
| Compound Name | N-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)butyl]aniline;trihydrochloride |
|---|---|
| PubChem CID | 22252291 |
| Molecular Formula | C18H32Cl3N3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)butyl]aniline;trihydrochloride |
| SMILES | Cl.Cl.Cl.c1ccc(NCCCCN2CCN3CCCCC3C2)cc1 |
| InChI | InChI=1S/C18H29N3.3ClH/c1-2-8-17(9-3-1)19-11-5-7-12-20-14-15-21-13-6-4-10-18(21)16-20;;;/h1-3,8-9,18-19H,4-7,10-16H2;3*1H |
| InChIKey | SNSJHLSKMMOYBK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|