C15H21FN2 — CID 79930326
2-[2-(2-fluorophenyl)ethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 79930326) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)ethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[2-(2-fluorophenyl)ethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79930326 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2-[2-(2-fluorophenyl)ethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Fc1ccccc1CCN1CCN2CCCC2C1 |
| InChI | InChI=1S/C15H21FN2/c16-15-6-2-1-4-13(15)7-9-17-10-11-18-8-3-5-14(18)12-17/h1-2,4,6,14H,3,5,7-12H2 |
| InChIKey | FGJKDBFZTPYSFD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |