C13H19ClN2S — CID 106043649
2-[2-(5-chlorothiophen-2-yl)ethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 106043649) has the molecular formula C13H19ClN2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)ethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)ethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 106043649 |
| Molecular Formula | C13H19ClN2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)ethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Clc1ccc(CCN2CCN3CCCC3C2)s1 |
| InChI | InChI=1S/C13H19ClN2S/c14-13-4-3-12(17-13)5-7-15-8-9-16-6-1-2-11(16)10-15/h3-4,11H,1-2,5-10H2 |
| InChIKey | ZYTQGKOYVOEWHV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |