C9H19Cl3N2 — CID 159084845
2-(2-chloroethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride (PubChem CID 159084845) has the molecular formula C9H19Cl3N2 and a molecular weight of 261.62 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride.
| Compound Name | 2-(2-chloroethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride |
|---|---|
| PubChem CID | 159084845 |
| Molecular Formula | C9H19Cl3N2 |
| Molecular Weight | 261.62 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-(2-chloroethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride |
| SMILES | Cl.Cl.ClCCN1CCN2CCCC2C1 |
| InChI | InChI=1S/C9H17ClN2.2ClH/c10-3-5-11-6-7-12-4-1-2-9(12)8-11;;/h9H,1-8H2;2*1H |
| InChIKey | KBHYIJHMMTZHIH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|