C11H21N2Y+2 — CID 23593660
2-propyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;yttrium(3+) (PubChem CID 23593660) has the molecular formula C11H21N2Y+2 and a molecular weight of 270.21 g/mol. Its IUPAC name is 2-propyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;yttrium(3+).
| Compound Name | 2-propyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;yttrium(3+) |
|---|---|
| PubChem CID | 23593660 |
| Molecular Formula | C11H21N2Y+2 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-propyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;yttrium(3+) |
| SMILES | [CH2-]CCN1CCN2CCCCC2C1.[Y+3] |
| InChI | InChI=1S/C11H21N2.Y/c1-2-6-12-8-9-13-7-4-3-5-11(13)10-12;/h11H,1-10H2;/q-1;+3 |
| InChIKey | MMJZUWBNXUFDKL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|