C14H27ClN2 — CID 79935954
2-(5-chloro-3-methylpentyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 79935954) has the molecular formula C14H27ClN2 and a molecular weight of 258.84 g/mol. Its IUPAC name is 2-(5-chloro-3-methylpentyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-(5-chloro-3-methylpentyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79935954 |
| Molecular Formula | C14H27ClN2 |
| Molecular Weight | 258.84 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 2-(5-chloro-3-methylpentyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CC(CCCl)CCN1CCN2CCCCC2C1 |
| InChI | InChI=1S/C14H27ClN2/c1-13(5-7-15)6-9-16-10-11-17-8-3-2-4-14(17)12-16/h13-14H,2-12H2,1H3 |
| InChIKey | XJWGYOBIQLJIRX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.84 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|