C10H19BrN2 — CID 63151080
2-(2-bromoethyl)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 63151080) has the molecular formula C10H19BrN2 and a molecular weight of 247.18 g/mol. Its IUPAC name is 2-(2-bromoethyl)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 2-(2-bromoethyl)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 63151080 |
| Molecular Formula | C10H19BrN2 |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-(2-bromoethyl)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | BrCCN1CCCN2CCCC2C1 |
| InChI | InChI=1S/C10H19BrN2/c11-4-8-12-5-2-7-13-6-1-3-10(13)9-12/h10H,1-9H2 |
| InChIKey | MAGFGIDNINBGPG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|