C22H29F2N3O2 — CID 19828441
4-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide;hydrate (PubChem CID 19828441) has the molecular formula C22H29F2N3O2 and a molecular weight of 405.49 g/mol. Its IUPAC name is 4-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide;hydrate.
| Compound Name | 4-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide;hydrate |
|---|---|
| PubChem CID | 19828441 |
| Molecular Formula | C22H29F2N3O2 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 4-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide;hydrate |
| SMILES | NC(=O)C1CN(CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)CCN1.O |
| InChI | InChI=1S/C22H27F2N3O.H2O/c23-18-8-4-16(5-9-18)20(17-6-10-19(24)11-7-17)3-1-2-13-27-14-12-26-21(15-27)22(25)28;/h4-11,20-21,26H,1-3,12-15H2,(H2,25,28);1H2 |
| InChIKey | PEFXBJIPNAYJBF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|