About 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide
1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide (PubChem CID 15087729) has the molecular formula C22H27F2N3O
and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide.
Molecular Properties
| Compound Name | 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide |
| PubChem CID | 15087729 |
| Molecular Formula | C22H27F2N3O |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1CCCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H27F2N3O/c23-18-8-4-16(5-9-18)20(17-6-10-19(24)11-7-17)3-1-2-13-27-14-12-26-15-21(27)22(25)28/h4-11,20-21,26H,1-3,12-15H2,(H2,25,28) |
| InChIKey | CFBSWLQCXLBXIA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide?
The IUPAC name of 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide (CID 15087729) is 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide.
What is the SMILES notation for 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide?
The canonical SMILES for 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide is NC(=O)C1CNCCN1CCCCC(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide?
The InChIKey is CFBSWLQCXLBXIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27F2N3O/c23-18-8-4-16(5-9-18)20(17-6-10-19(24)11-7-17)3-1-2-13-27-14-12-26-15-21(27)22(25)28/h4-11,20-21,26H,1-3,12-15H2,(H2,25,28).
What are the key properties of 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide?
1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide has a molecular weight of 387.47 g/mol, XLogP of 3.03, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide is sourced from PubChem (CID 15087729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).