C22H27F2N3O — CID 15087729
1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide (PubChem CID 15087729) has the molecular formula C22H27F2N3O and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide.
| Compound Name | 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 15087729 |
| Molecular Formula | C22H27F2N3O |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1CCCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H27F2N3O/c23-18-8-4-16(5-9-18)20(17-6-10-19(24)11-7-17)3-1-2-13-27-14-12-26-15-21(27)22(25)28/h4-11,20-21,26H,1-3,12-15H2,(H2,25,28) |
| InChIKey | CFBSWLQCXLBXIA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|