C12H14BrF2N3O — CID 106264875
1-[(3-bromo-2,6-difluorophenyl)methyl]piperazine-2-carboxamide (PubChem CID 106264875) has the molecular formula C12H14BrF2N3O and a molecular weight of 334.16 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]piperazine-2-carboxamide.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 106264875 |
| Molecular Formula | C12H14BrF2N3O |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]piperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H14BrF2N3O/c13-8-1-2-9(14)7(11(8)15)6-18-4-3-17-5-10(18)12(16)19/h1-2,10,17H,3-6H2,(H2,16,19) |
| InChIKey | DZFRQISSIGIUMN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|