C13H16FI2N3O — CID 170281869
(2S)-1-[[2-[fluoro(diiodo)methyl]phenyl]methyl]piperazine-2-carboxamide (PubChem CID 170281869) has the molecular formula C13H16FI2N3O and a molecular weight of 503.10 g/mol. Its IUPAC name is (2S)-1-[[2-[fluoro(diiodo)methyl]phenyl]methyl]piperazine-2-carboxamide.
| Compound Name | (2S)-1-[[2-[fluoro(diiodo)methyl]phenyl]methyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 170281869 |
| Molecular Formula | C13H16FI2N3O |
| Molecular Weight | 503.10 g/mol |
| Exact Mass | 502.94 |
| IUPAC Name | (2S)-1-[[2-[fluoro(diiodo)methyl]phenyl]methyl]piperazine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CNCCN1Cc1ccccc1C(F)(I)I |
| InChI | InChI=1S/C13H16FI2N3O/c14-13(15,16)10-4-2-1-3-9(10)8-19-6-5-18-7-11(19)12(17)20/h1-4,11,18H,5-8H2,(H2,17,20)/t11-/m0/s1 |
| InChIKey | JRZRCJCMMNPWLO-NSHDSACASA-N |
| XLogP | 1.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.10 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|