C19H23N5O4 — CID 167729974
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]piperazine-2-carboxamide (PubChem CID 167729974) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]piperazine-2-carboxamide.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 167729974 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]methyl]piperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H23N5O4/c20-17(26)15-8-21-6-7-23(15)9-11-2-1-3-12-13(11)10-24(19(12)28)14-4-5-16(25)22-18(14)27/h1-3,14-15,21H,4-10H2,(H2,20,26)(H,22,25,27) |
| InChIKey | CZKIUONRJHZYRD-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|