C32H38F2N4O3 — CID 14722610
1-[5,5-bis(4-fluorophenyl)pentyl]-4-[2-(4-hydroxy-2,6-dimethylanilino)-2-oxoethyl]piperazine-2-carboxamide (PubChem CID 14722610) has the molecular formula C32H38F2N4O3 and a molecular weight of 564.68 g/mol. Its IUPAC name is 1-[5,5-bis(4-fluorophenyl)pentyl]-4-[2-(4-hydroxy-2,6-dimethylanilino)-2-oxoethyl]piperazine-2-carboxamide.
| Compound Name | 1-[5,5-bis(4-fluorophenyl)pentyl]-4-[2-(4-hydroxy-2,6-dimethylanilino)-2-oxoethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 14722610 |
| Molecular Formula | C32H38F2N4O3 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 1-[5,5-bis(4-fluorophenyl)pentyl]-4-[2-(4-hydroxy-2,6-dimethylanilino)-2-oxoethyl]piperazine-2-carboxamide |
| SMILES | Cc1cc(O)cc(C)c1NC(=O)CN1CCN(CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)C(C(N)=O)C1 |
| InChI | InChI=1S/C32H38F2N4O3/c1-21-17-27(39)18-22(2)31(21)36-30(40)20-37-15-16-38(29(19-37)32(35)41)14-4-3-5-28(23-6-10-25(33)11-7-23)24-8-12-26(34)13-9-24/h6-13,17-18,28-29,39H,3-5,14-16,19-20H2,1-2H3,(H2,35,41)(H,36,40) |
| InChIKey | WLFNXJQZIMWWNS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|