C35H40F2N4O6 — CID 86742390
1-[4,4-bis(4-fluorophenyl)butyl]-4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazine-2-carboxamide;(Z)-but-2-enedioic acid (PubChem CID 86742390) has the molecular formula C35H40F2N4O6 and a molecular weight of 650.72 g/mol. Its IUPAC name is 1-[4,4-bis(4-fluorophenyl)butyl]-4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazine-2-carboxamide;(Z)-but-2-enedioic acid.
| Compound Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazine-2-carboxamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 86742390 |
| Molecular Formula | C35H40F2N4O6 |
| Molecular Weight | 650.72 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazine-2-carboxamide;(Z)-but-2-enedioic acid |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)C(C(N)=O)C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C31H36F2N4O2.C4H4O4/c1-21-5-3-6-22(2)30(21)35-29(38)20-36-17-18-37(28(19-36)31(34)39)16-4-7-27(23-8-12-25(32)13-9-23)24-10-14-26(33)15-11-24;5-3(6)1-2-4(7)8/h3,5-6,8-15,27-28H,4,7,16-20H2,1-2H3,(H2,34,39)(H,35,38);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | XBBQFRJZTPITGT-BTJKTKAUSA-N |
| XLogP | 4.32 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|