C32H36Cl4F2N4O3 — CID 22373104
4-[2-(4-acetyl-2,6-dichloroanilino)-2-oxoethyl]-1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide;dihydrochloride (PubChem CID 22373104) has the molecular formula C32H36Cl4F2N4O3 and a molecular weight of 704.47 g/mol. Its IUPAC name is 4-[2-(4-acetyl-2,6-dichloroanilino)-2-oxoethyl]-1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide;dihydrochloride.
| Compound Name | 4-[2-(4-acetyl-2,6-dichloroanilino)-2-oxoethyl]-1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 22373104 |
| Molecular Formula | C32H36Cl4F2N4O3 |
| Molecular Weight | 704.47 g/mol |
| Exact Mass | 702.15 |
| IUPAC Name | 4-[2-(4-acetyl-2,6-dichloroanilino)-2-oxoethyl]-1-[5,5-bis(4-fluorophenyl)pentyl]piperazine-2-carboxamide;dihydrochloride |
| SMILES | CC(=O)c1cc(Cl)c(NC(=O)CN2CCN(CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)C(C(N)=O)C2)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C32H34Cl2F2N4O3.2ClH/c1-20(41)23-16-27(33)31(28(34)17-23)38-30(42)19-39-14-15-40(29(18-39)32(37)43)13-3-2-4-26(21-5-9-24(35)10-6-21)22-7-11-25(36)12-8-22;;/h5-12,16-17,26,29H,2-4,13-15,18-19H2,1H3,(H2,37,43)(H,38,42);2*1H |
| InChIKey | UIHIDPXDBBYPHE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.47 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|