C25H31F2N3O — CID 21295649
7-[4,4-bis(4-fluorophenyl)butyl]-2,3,3-trimethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-1-one (PubChem CID 21295649) has the molecular formula C25H31F2N3O and a molecular weight of 427.54 g/mol. Its IUPAC name is 7-[4,4-bis(4-fluorophenyl)butyl]-2,3,3-trimethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-1-one.
| Compound Name | 7-[4,4-bis(4-fluorophenyl)butyl]-2,3,3-trimethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-1-one |
|---|---|
| PubChem CID | 21295649 |
| Molecular Formula | C25H31F2N3O |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 7-[4,4-bis(4-fluorophenyl)butyl]-2,3,3-trimethyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-1-one |
| SMILES | CN1C(=O)C2CN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CCN2C1(C)C |
| InChI | InChI=1S/C25H31F2N3O/c1-25(2)28(3)24(31)23-17-29(15-16-30(23)25)14-4-5-22(18-6-10-20(26)11-7-18)19-8-12-21(27)13-9-19/h6-13,22-23H,4-5,14-17H2,1-3H3 |
| InChIKey | AMLRCPCDHFWKBZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |