C25H35N3O3 — CID 67281866
[1-(4-tert-butylphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl] carbamate (PubChem CID 67281866) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is [1-(4-tert-butylphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl] carbamate.
| Compound Name | [1-(4-tert-butylphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl] carbamate |
|---|---|
| PubChem CID | 67281866 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | [1-(4-tert-butylphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl] carbamate |
| SMILES | COc1ccc(N2CCN(CCC(OC(N)=O)c3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H35N3O3/c1-25(2,3)20-7-5-19(6-8-20)23(31-24(26)29)13-14-27-15-17-28(18-16-27)21-9-11-22(30-4)12-10-21/h5-12,23H,13-18H2,1-4H3,(H2,26,29) |
| InChIKey | VANBIMCEYMFDOW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|