C22H26F3N3O3 — CID 68660079
[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]propyl] carbamate (PubChem CID 68660079) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is [3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]propyl] carbamate.
| Compound Name | [3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]propyl] carbamate |
|---|---|
| PubChem CID | 68660079 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | [3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-[4-(trifluoromethyl)phenyl]propyl] carbamate |
| SMILES | COc1ccc(N2CCN(C(CCOC(N)=O)c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26F3N3O3/c1-30-19-8-6-18(7-9-19)27-11-13-28(14-12-27)20(10-15-31-21(26)29)16-2-4-17(5-3-16)22(23,24)25/h2-9,20H,10-15H2,1H3,(H2,26,29) |
| InChIKey | HMGYZRXITGDJAG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|