C21H26FNO3 — CID 42867792
4-[3-(2-fluoro-5-methylphenoxy)-3-(4-methoxyphenyl)propyl]morpholine (PubChem CID 42867792) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is 4-[3-(2-fluoro-5-methylphenoxy)-3-(4-methoxyphenyl)propyl]morpholine.
| Compound Name | 4-[3-(2-fluoro-5-methylphenoxy)-3-(4-methoxyphenyl)propyl]morpholine |
|---|---|
| PubChem CID | 42867792 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-[3-(2-fluoro-5-methylphenoxy)-3-(4-methoxyphenyl)propyl]morpholine |
| SMILES | COc1ccc(C(CCN2CCOCC2)Oc2cc(C)ccc2F)cc1 |
| InChI | InChI=1S/C21H26FNO3/c1-16-3-8-19(22)21(15-16)26-20(9-10-23-11-13-25-14-12-23)17-4-6-18(24-2)7-5-17/h3-8,15,20H,9-14H2,1-2H3 |
| InChIKey | YGFFAUXVQANYRB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |