C20H23ClFNO2 — CID 42867876
4-[3-(4-chlorophenyl)-3-(4-fluoro-2-methylphenoxy)propyl]morpholine (PubChem CID 42867876) has the molecular formula C20H23ClFNO2 and a molecular weight of 363.86 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-3-(4-fluoro-2-methylphenoxy)propyl]morpholine.
| Compound Name | 4-[3-(4-chlorophenyl)-3-(4-fluoro-2-methylphenoxy)propyl]morpholine |
|---|---|
| PubChem CID | 42867876 |
| Molecular Formula | C20H23ClFNO2 |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-3-(4-fluoro-2-methylphenoxy)propyl]morpholine |
| SMILES | Cc1cc(F)ccc1OC(CCN1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClFNO2/c1-15-14-18(22)6-7-19(15)25-20(16-2-4-17(21)5-3-16)8-9-23-10-12-24-13-11-23/h2-7,14,20H,8-13H2,1H3 |
| InChIKey | XFRDQQKGACDTGF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |