C26H27Cl2FN2O — CID 42867881
1-benzyl-4-[3-(2-chloro-4-fluorophenoxy)-3-(4-chlorophenyl)propyl]piperazine (PubChem CID 42867881) has the molecular formula C26H27Cl2FN2O and a molecular weight of 473.42 g/mol. Its IUPAC name is 1-benzyl-4-[3-(2-chloro-4-fluorophenoxy)-3-(4-chlorophenyl)propyl]piperazine.
| Compound Name | 1-benzyl-4-[3-(2-chloro-4-fluorophenoxy)-3-(4-chlorophenyl)propyl]piperazine |
|---|---|
| PubChem CID | 42867881 |
| Molecular Formula | C26H27Cl2FN2O |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-benzyl-4-[3-(2-chloro-4-fluorophenoxy)-3-(4-chlorophenyl)propyl]piperazine |
| SMILES | Fc1ccc(OC(CCN2CCN(Cc3ccccc3)CC2)c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H27Cl2FN2O/c27-22-8-6-21(7-9-22)25(32-26-11-10-23(29)18-24(26)28)12-13-30-14-16-31(17-15-30)19-20-4-2-1-3-5-20/h1-11,18,25H,12-17,19H2 |
| InChIKey | JCOJDUDEFOFHDT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |