C28H33ClN2O2 — CID 46068930
1-benzyl-4-[3-(3-chlorophenyl)-3-(2-methoxy-4-methylphenoxy)propyl]piperazine (PubChem CID 46068930) has the molecular formula C28H33ClN2O2 and a molecular weight of 465.04 g/mol. Its IUPAC name is 1-benzyl-4-[3-(3-chlorophenyl)-3-(2-methoxy-4-methylphenoxy)propyl]piperazine.
| Compound Name | 1-benzyl-4-[3-(3-chlorophenyl)-3-(2-methoxy-4-methylphenoxy)propyl]piperazine |
|---|---|
| PubChem CID | 46068930 |
| Molecular Formula | C28H33ClN2O2 |
| Molecular Weight | 465.04 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 1-benzyl-4-[3-(3-chlorophenyl)-3-(2-methoxy-4-methylphenoxy)propyl]piperazine |
| SMILES | COc1cc(C)ccc1OC(CCN1CCN(Cc2ccccc2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H33ClN2O2/c1-22-11-12-27(28(19-22)32-2)33-26(24-9-6-10-25(29)20-24)13-14-30-15-17-31(18-16-30)21-23-7-4-3-5-8-23/h3-12,19-20,26H,13-18,21H2,1-2H3 |
| InChIKey | NPNVMSYXTIJNRZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.04 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |