C27H31ClN2O2 — CID 92998656
1-benzyl-4-[(3R)-3-(3-chlorophenyl)-3-(4-methoxyphenoxy)propyl]piperazine (PubChem CID 92998656) has the molecular formula C27H31ClN2O2 and a molecular weight of 451.01 g/mol. Its IUPAC name is 1-benzyl-4-[(3R)-3-(3-chlorophenyl)-3-(4-methoxyphenoxy)propyl]piperazine.
| Compound Name | 1-benzyl-4-[(3R)-3-(3-chlorophenyl)-3-(4-methoxyphenoxy)propyl]piperazine |
|---|---|
| PubChem CID | 92998656 |
| Molecular Formula | C27H31ClN2O2 |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-benzyl-4-[(3R)-3-(3-chlorophenyl)-3-(4-methoxyphenoxy)propyl]piperazine |
| SMILES | COc1ccc(O[C@H](CCN2CCN(Cc3ccccc3)CC2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C27H31ClN2O2/c1-31-25-10-12-26(13-11-25)32-27(23-8-5-9-24(28)20-23)14-15-29-16-18-30(19-17-29)21-22-6-3-2-4-7-22/h2-13,20,27H,14-19,21H2,1H3/t27-/m1/s1 |
| InChIKey | GYKQLXVWLRORFW-HHHXNRCGSA-N |
| XLogP | 5.68 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |