C25H28ClFN2OS — CID 42867903
1-benzyl-4-[3-(5-chlorothiophen-2-yl)-3-(2-fluoro-5-methylphenoxy)propyl]piperazine (PubChem CID 42867903) has the molecular formula C25H28ClFN2OS and a molecular weight of 459.03 g/mol. Its IUPAC name is 1-benzyl-4-[3-(5-chlorothiophen-2-yl)-3-(2-fluoro-5-methylphenoxy)propyl]piperazine.
| Compound Name | 1-benzyl-4-[3-(5-chlorothiophen-2-yl)-3-(2-fluoro-5-methylphenoxy)propyl]piperazine |
|---|---|
| PubChem CID | 42867903 |
| Molecular Formula | C25H28ClFN2OS |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-benzyl-4-[3-(5-chlorothiophen-2-yl)-3-(2-fluoro-5-methylphenoxy)propyl]piperazine |
| SMILES | Cc1ccc(F)c(OC(CCN2CCN(Cc3ccccc3)CC2)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C25H28ClFN2OS/c1-19-7-8-21(27)23(17-19)30-22(24-9-10-25(26)31-24)11-12-28-13-15-29(16-14-28)18-20-5-3-2-4-6-20/h2-10,17,22H,11-16,18H2,1H3 |
| InChIKey | ZNYAGDZTCRNLAK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |