C18H27NO3 — CID 124507229
(2S)-1-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-2-ethoxypropan-1-one (PubChem CID 124507229) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2S)-1-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-2-ethoxypropan-1-one.
| Compound Name | (2S)-1-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-2-ethoxypropan-1-one |
|---|---|
| PubChem CID | 124507229 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (2S)-1-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-2-ethoxypropan-1-one |
| SMILES | CCO[C@@H](C)C(=O)N1CCC(Oc2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C18H27NO3/c1-5-21-15(4)18(20)19-10-8-16(9-11-19)22-17-7-6-13(2)14(3)12-17/h6-7,12,15-16H,5,8-11H2,1-4H3/t15-/m0/s1 |
| InChIKey | UPBZTGMYSLMTKC-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |