C18H24N2O3 — CID 129368292
(5S)-5-[4-(3,4-dimethylphenoxy)piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 129368292) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (5S)-5-[4-(3,4-dimethylphenoxy)piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[4-(3,4-dimethylphenoxy)piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129368292 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (5S)-5-[4-(3,4-dimethylphenoxy)piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(OC2CCN(C(=O)[C@@H]3CCC(=O)N3)CC2)cc1C |
| InChI | InChI=1S/C18H24N2O3/c1-12-3-4-15(11-13(12)2)23-14-7-9-20(10-8-14)18(22)16-5-6-17(21)19-16/h3-4,11,14,16H,5-10H2,1-2H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | WXKRCNGIWQJUDA-INIZCTEOSA-N |
| XLogP | 1.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |