C29H38F3N5O4 — CID 70845327
1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 70845327) has the molecular formula C29H38F3N5O4 and a molecular weight of 577.65 g/mol. Its IUPAC name is 1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70845327 |
| Molecular Formula | C29H38F3N5O4 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | CC(C)COc1cc(NC2CCN(C(=O)CCN3CCN(c4ccc(C(F)(F)F)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H38F3N5O4/c1-21(2)20-41-27-19-24(5-8-26(27)37(39)40)33-23-9-13-36(14-10-23)28(38)11-12-34-15-17-35(18-16-34)25-6-3-22(4-7-25)29(30,31)32/h3-8,19,21,23,33H,9-18,20H2,1-2H3 |
| InChIKey | XCLATWKVHGSNIO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|