C29H41Cl2N5O4 — CID 162249968
3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]propan-1-one;methane (PubChem CID 162249968) has the molecular formula C29H41Cl2N5O4 and a molecular weight of 594.58 g/mol. Its IUPAC name is 3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]propan-1-one;methane.
| Compound Name | 3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]propan-1-one;methane |
|---|---|
| PubChem CID | 162249968 |
| Molecular Formula | C29H41Cl2N5O4 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | 3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]propan-1-one;methane |
| SMILES | C.CC(C)COc1cc(NC2CCN(C(=O)CCN3CCN(c4ccc(Cl)c(Cl)c4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H37Cl2N5O4.CH4/c1-20(2)19-39-27-17-22(3-6-26(27)35(37)38)31-21-7-11-34(12-8-21)28(36)9-10-32-13-15-33(16-14-32)23-4-5-24(29)25(30)18-23;/h3-6,17-18,20-21,31H,7-16,19H2,1-2H3;1H4 |
| InChIKey | ZXVVHZMUOQSMGI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|