C30H31F6N5O3 — CID 134166845
4-nitro-3-(trifluoromethyl)-N-[4-[[2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-4-pyridinyl]oxy]cyclohexyl]aniline (PubChem CID 134166845) has the molecular formula C30H31F6N5O3 and a molecular weight of 623.60 g/mol. Its IUPAC name is 4-nitro-3-(trifluoromethyl)-N-[4-[[2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-4-pyridinyl]oxy]cyclohexyl]aniline.
| Compound Name | 4-nitro-3-(trifluoromethyl)-N-[4-[[2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-4-pyridinyl]oxy]cyclohexyl]aniline |
|---|---|
| PubChem CID | 134166845 |
| Molecular Formula | C30H31F6N5O3 |
| Molecular Weight | 623.60 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 4-nitro-3-(trifluoromethyl)-N-[4-[[2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-4-pyridinyl]oxy]cyclohexyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(NC2CCC(Oc3ccnc(N4CCN(Cc5ccc(C(F)(F)F)cc5)CC4)c3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C30H31F6N5O3/c31-29(32,33)21-3-1-20(2-4-21)19-39-13-15-40(16-14-39)28-18-25(11-12-37-28)44-24-8-5-22(6-9-24)38-23-7-10-27(41(42)43)26(17-23)30(34,35)36/h1-4,7,10-12,17-18,22,24,38H,5-6,8-9,13-16,19H2 |
| InChIKey | MNZSKWNLOMCRCK-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|