C27H34F3N5O5 — CID 134166854
3-ethoxy-1-[4-[4-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazin-1-yl]propan-1-one (PubChem CID 134166854) has the molecular formula C27H34F3N5O5 and a molecular weight of 565.59 g/mol. Its IUPAC name is 3-ethoxy-1-[4-[4-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-ethoxy-1-[4-[4-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 134166854 |
| Molecular Formula | C27H34F3N5O5 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 3-ethoxy-1-[4-[4-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazin-1-yl]propan-1-one |
| SMILES | CCOCCC(=O)N1CCN(c2cc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)ccn2)CC1 |
| InChI | InChI=1S/C27H34F3N5O5/c1-2-39-16-10-26(36)34-14-12-33(13-15-34)25-18-22(9-11-31-25)40-21-6-3-19(4-7-21)32-20-5-8-24(35(37)38)23(17-20)27(28,29)30/h5,8-9,11,17-19,21,32H,2-4,6-7,10,12-16H2,1H3 |
| InChIKey | POTACDYUQWLEAN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|