C25H25ClF3N3O6 — CID 158312122
4-(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-N-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-oxobutanamide (PubChem CID 158312122) has the molecular formula C25H25ClF3N3O6 and a molecular weight of 555.94 g/mol. Its IUPAC name is 4-(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-N-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-oxobutanamide.
| Compound Name | 4-(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-N-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-oxobutanamide |
|---|---|
| PubChem CID | 158312122 |
| Molecular Formula | C25H25ClF3N3O6 |
| Molecular Weight | 555.94 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 4-(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-N-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-oxobutanamide |
| SMILES | O=C(CCC1Cc2cc(Cl)ccc2O1)C(=O)NOC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H25ClF3N3O6/c26-15-1-10-23-14(11-15)12-19(37-23)7-9-22(33)24(34)31-38-18-5-2-16(3-6-18)30-17-4-8-21(32(35)36)20(13-17)25(27,28)29/h1,4,8,10-11,13,16,18-19,30H,2-3,5-7,9,12H2,(H,31,34) |
| InChIKey | XDJWZDUGJNJHTB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|