C29H29F6N5O4 — CID 90176564
2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-[4-[6-(trifluoromethyl)quinolin-2-yl]piperazin-1-yl]acetaldehyde (PubChem CID 90176564) has the molecular formula C29H29F6N5O4 and a molecular weight of 625.57 g/mol. Its IUPAC name is 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-[4-[6-(trifluoromethyl)quinolin-2-yl]piperazin-1-yl]acetaldehyde.
| Compound Name | 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-[4-[6-(trifluoromethyl)quinolin-2-yl]piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 90176564 |
| Molecular Formula | C29H29F6N5O4 |
| Molecular Weight | 625.57 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-[4-[6-(trifluoromethyl)quinolin-2-yl]piperazin-1-yl]acetaldehyde |
| SMILES | O=CC(OC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(c2ccc3cc(C(F)(F)F)ccc3n2)CC1 |
| InChI | InChI=1S/C29H29F6N5O4/c30-28(31,32)19-2-8-24-18(15-19)1-10-26(37-24)38-11-13-39(14-12-38)27(17-41)44-22-6-3-20(4-7-22)36-21-5-9-25(40(42)43)23(16-21)29(33,34)35/h1-2,5,8-10,15-17,20,22,27,36H,3-4,6-7,11-14H2 |
| InChIKey | GFXVZYCRIOVTAW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|