C26H34F3N5O5S — CID 58576253
1-[2-[4-(4-ethoxyphenyl)piperazin-1-yl]ethylsulfonyl]-N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 58576253) has the molecular formula C26H34F3N5O5S and a molecular weight of 585.65 g/mol. Its IUPAC name is 1-[2-[4-(4-ethoxyphenyl)piperazin-1-yl]ethylsulfonyl]-N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 1-[2-[4-(4-ethoxyphenyl)piperazin-1-yl]ethylsulfonyl]-N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 58576253 |
| Molecular Formula | C26H34F3N5O5S |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 1-[2-[4-(4-ethoxyphenyl)piperazin-1-yl]ethylsulfonyl]-N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | CCOc1ccc(N2CCN(CCS(=O)(=O)N3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H34F3N5O5S/c1-2-39-23-6-4-22(5-7-23)32-15-13-31(14-16-32)17-18-40(37,38)33-11-9-20(10-12-33)30-21-3-8-25(34(35)36)24(19-21)26(27,28)29/h3-8,19-20,30H,2,9-18H2,1H3 |
| InChIKey | VUJYZUIBOFATNS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|