C23H38F3N5O4S — CID 159243782
1-[2-(4-butylpiperazin-1-yl)ethylsulfonyl]-N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-amine;methane (PubChem CID 159243782) has the molecular formula C23H38F3N5O4S and a molecular weight of 537.65 g/mol. Its IUPAC name is 1-[2-(4-butylpiperazin-1-yl)ethylsulfonyl]-N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-amine;methane.
| Compound Name | 1-[2-(4-butylpiperazin-1-yl)ethylsulfonyl]-N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-amine;methane |
|---|---|
| PubChem CID | 159243782 |
| Molecular Formula | C23H38F3N5O4S |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 1-[2-(4-butylpiperazin-1-yl)ethylsulfonyl]-N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-4-amine;methane |
| SMILES | C.CCCCN1CCN(CCS(=O)(=O)N2CCC(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H34F3N5O4S.CH4/c1-2-3-8-27-11-13-28(14-12-27)15-16-35(33,34)29-9-6-18(7-10-29)26-19-4-5-21(30(31)32)20(17-19)22(23,24)25;/h4-5,17-18,26H,2-3,6-16H2,1H3;1H4 |
| InChIKey | KUKQGVDGGPKNAF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|