C24H38F3N5O5S — CID 159827096
methane;1-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]sulfonylethyl]piperazin-1-yl]pentan-1-one (PubChem CID 159827096) has the molecular formula C24H38F3N5O5S and a molecular weight of 565.66 g/mol. Its IUPAC name is methane;1-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]sulfonylethyl]piperazin-1-yl]pentan-1-one.
| Compound Name | methane;1-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]sulfonylethyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 159827096 |
| Molecular Formula | C24H38F3N5O5S |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | methane;1-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]sulfonylethyl]piperazin-1-yl]pentan-1-one |
| SMILES | C.CCCCC(=O)N1CCN(CCS(=O)(=O)N2CCC(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H34F3N5O5S.CH4/c1-2-3-4-22(32)29-13-11-28(12-14-29)15-16-37(35,36)30-9-7-18(8-10-30)27-19-5-6-21(31(33)34)20(17-19)23(24,25)26;/h5-6,17-18,27H,2-4,7-16H2,1H3;1H4 |
| InChIKey | NMZBERPNNORWIV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|