C25H36F3N5O4 — CID 58577092
N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]-N-[(1-pentanoylpiperidin-4-yl)methyl]piperidine-1-carboxamide (PubChem CID 58577092) has the molecular formula C25H36F3N5O4 and a molecular weight of 527.59 g/mol. Its IUPAC name is N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]-N-[(1-pentanoylpiperidin-4-yl)methyl]piperidine-1-carboxamide.
| Compound Name | N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]-N-[(1-pentanoylpiperidin-4-yl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58577092 |
| Molecular Formula | C25H36F3N5O4 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]-N-[(1-pentanoylpiperidin-4-yl)methyl]piperidine-1-carboxamide |
| SMILES | CCCCC(=O)N1CCC(CN(C)C(=O)N2CCC(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H36F3N5O4/c1-3-4-5-23(34)31-12-8-18(9-13-31)17-30(2)24(35)32-14-10-19(11-15-32)29-20-6-7-22(33(36)37)21(16-20)25(26,27)28/h6-7,16,18-19,29H,3-5,8-15,17H2,1-2H3 |
| InChIKey | BBKMOWHATJKYEK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|