C30H38F3N5O4 — CID 162561754
[3-[hydroxy-(4-phenylpiperazin-1-yl)methyl]cyclohexyl]-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]methanone (PubChem CID 162561754) has the molecular formula C30H38F3N5O4 and a molecular weight of 589.66 g/mol. Its IUPAC name is [3-[hydroxy-(4-phenylpiperazin-1-yl)methyl]cyclohexyl]-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]methanone.
| Compound Name | [3-[hydroxy-(4-phenylpiperazin-1-yl)methyl]cyclohexyl]-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 162561754 |
| Molecular Formula | C30H38F3N5O4 |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | [3-[hydroxy-(4-phenylpiperazin-1-yl)methyl]cyclohexyl]-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCC(C(O)N2CCN(c3ccccc3)CC2)C1)N1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C30H38F3N5O4/c31-30(32,33)26-20-24(9-10-27(26)38(41)42)34-23-11-13-36(14-12-23)28(39)21-5-4-6-22(19-21)29(40)37-17-15-35(16-18-37)25-7-2-1-3-8-25/h1-3,7-10,20-23,29,34,40H,4-6,11-19H2 |
| InChIKey | JBGVLUGWXNDTAW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|