C27H34F3N5O3 — CID 162556967
N-methyl-1-(4-methylphenyl)-N-[[1-[4-nitro-3-(trifluoromethyl)anilino]piperidin-4-yl]methyl]piperidine-4-carboxamide (PubChem CID 162556967) has the molecular formula C27H34F3N5O3 and a molecular weight of 533.60 g/mol. Its IUPAC name is N-methyl-1-(4-methylphenyl)-N-[[1-[4-nitro-3-(trifluoromethyl)anilino]piperidin-4-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-methyl-1-(4-methylphenyl)-N-[[1-[4-nitro-3-(trifluoromethyl)anilino]piperidin-4-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162556967 |
| Molecular Formula | C27H34F3N5O3 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-methyl-1-(4-methylphenyl)-N-[[1-[4-nitro-3-(trifluoromethyl)anilino]piperidin-4-yl]methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(N2CCC(C(=O)N(C)CC3CCN(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H34F3N5O3/c1-19-3-6-23(7-4-19)33-13-11-21(12-14-33)26(36)32(2)18-20-9-15-34(16-10-20)31-22-5-8-25(35(37)38)24(17-22)27(28,29)30/h3-8,17,20-21,31H,9-16,18H2,1-2H3 |
| InChIKey | GMLFXMKRQILTBR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|