C33H40N4O5 — CID 58576327
1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]-3-[4-(4-phenoxyphenyl)piperidin-1-yl]propan-1-one (PubChem CID 58576327) has the molecular formula C33H40N4O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is 1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]-3-[4-(4-phenoxyphenyl)piperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]-3-[4-(4-phenoxyphenyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576327 |
| Molecular Formula | C33H40N4O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]-3-[4-(4-phenoxyphenyl)piperidin-1-yl]propan-1-one |
| SMILES | CCOc1cc(NC2CCN(C(=O)CCN3CCC(c4ccc(Oc5ccccc5)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H40N4O5/c1-2-41-32-24-28(10-13-31(32)37(39)40)34-27-16-22-36(23-17-27)33(38)18-21-35-19-14-26(15-20-35)25-8-11-30(12-9-25)42-29-6-4-3-5-7-29/h3-13,24,26-27,34H,2,14-23H2,1H3 |
| InChIKey | KTTLNQQPBCPKKE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|