C29H30F3N3O5 — CID 161463663
3-(6-methylnaphthalen-2-yl)-N-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethyl]-2-oxopropanamide (PubChem CID 161463663) has the molecular formula C29H30F3N3O5 and a molecular weight of 557.57 g/mol. Its IUPAC name is 3-(6-methylnaphthalen-2-yl)-N-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethyl]-2-oxopropanamide.
| Compound Name | 3-(6-methylnaphthalen-2-yl)-N-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 161463663 |
| Molecular Formula | C29H30F3N3O5 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 3-(6-methylnaphthalen-2-yl)-N-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethyl]-2-oxopropanamide |
| SMILES | Cc1ccc2cc(CC(=O)C(=O)NCCOC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)ccc2c1 |
| InChI | InChI=1S/C29H30F3N3O5/c1-18-2-4-21-15-19(3-5-20(21)14-18)16-27(36)28(37)33-12-13-40-24-9-6-22(7-10-24)34-23-8-11-26(35(38)39)25(17-23)29(30,31)32/h2-5,8,11,14-15,17,22,24,34H,6-7,9-10,12-13,16H2,1H3,(H,33,37) |
| InChIKey | WCDKKPIMBCJXDE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|