C14H16ClN3O2 — CID 129381802
N-(2-chloro-4-methylphenyl)-N'-[(2R)-1-cyanopropan-2-yl]-N'-methyloxamide (PubChem CID 129381802) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-N'-[(2R)-1-cyanopropan-2-yl]-N'-methyloxamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-N'-[(2R)-1-cyanopropan-2-yl]-N'-methyloxamide |
|---|---|
| PubChem CID | 129381802 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-N'-[(2R)-1-cyanopropan-2-yl]-N'-methyloxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N(C)[C@H](C)CC#N)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-9-4-5-12(11(15)8-9)17-13(19)14(20)18(3)10(2)6-7-16/h4-5,8,10H,6H2,1-3H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | DANVDVPXBJVLBF-SNVBAGLBSA-N |
| XLogP | 2.35 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|