C18H28N2O — CID 86029500
3-[3-(4-cyclopentylbutyl)phenyl]-1,1-dimethylurea (PubChem CID 86029500) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-[3-(4-cyclopentylbutyl)phenyl]-1,1-dimethylurea.
| Compound Name | 3-[3-(4-cyclopentylbutyl)phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 86029500 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 3-[3-(4-cyclopentylbutyl)phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cccc(CCCCC2CCCC2)c1 |
| InChI | InChI=1S/C18H28N2O/c1-20(2)18(21)19-17-13-7-12-16(14-17)11-6-5-10-15-8-3-4-9-15/h7,12-15H,3-6,8-11H2,1-2H3,(H,19,21) |
| InChIKey | NKENSNLQNDNZHA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|