C20H26N2O2 — CID 86097680
3-[3-[3-methoxy-3-(4-methylphenyl)propyl]phenyl]-1,1-dimethylurea (PubChem CID 86097680) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-[3-[3-methoxy-3-(4-methylphenyl)propyl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[3-[3-methoxy-3-(4-methylphenyl)propyl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 86097680 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3-[3-[3-methoxy-3-(4-methylphenyl)propyl]phenyl]-1,1-dimethylurea |
| SMILES | COC(CCc1cccc(NC(=O)N(C)C)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-15-8-11-17(12-9-15)19(24-4)13-10-16-6-5-7-18(14-16)21-20(23)22(2)3/h5-9,11-12,14,19H,10,13H2,1-4H3,(H,21,23) |
| InChIKey | QTWWXMMFLWCZAN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |