C21H22N2O4 — CID 60536120
(2E,4E)-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]hexa-2,4-dienamide (PubChem CID 60536120) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is (2E,4E)-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 60536120 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (2E,4E)-N-[3-[[2-(2-methoxyphenoxy)acetyl]amino]phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cccc(NC(=O)COc2ccccc2OC)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-3-4-5-13-20(24)22-16-9-8-10-17(14-16)23-21(25)15-27-19-12-7-6-11-18(19)26-2/h3-14H,15H2,1-2H3,(H,22,24)(H,23,25)/b4-3+,13-5+ |
| InChIKey | AGIWSYBDRIRGIE-HJSZHNSDSA-N |
| XLogP | 3.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|