C18H18N2O3S — CID 17460381
(2E,4E)-N-[4-(phenylsulfamoyl)phenyl]hexa-2,4-dienamide (PubChem CID 17460381) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is (2E,4E)-N-[4-(phenylsulfamoyl)phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[4-(phenylsulfamoyl)phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 17460381 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2E,4E)-N-[4-(phenylsulfamoyl)phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-2-3-5-10-18(21)19-15-11-13-17(14-12-15)24(22,23)20-16-8-6-4-7-9-16/h2-14,20H,1H3,(H,19,21)/b3-2+,10-5+ |
| InChIKey | ACCNHGHMWDEIQA-XPQLPGEHSA-N |
| XLogP | 3.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|