C15H20N2O3S — CID 95333326
(2E,4E)-N-methyl-N-[(1R)-1-(3-sulfamoylphenyl)ethyl]hexa-2,4-dienamide (PubChem CID 95333326) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is (2E,4E)-N-methyl-N-[(1R)-1-(3-sulfamoylphenyl)ethyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-methyl-N-[(1R)-1-(3-sulfamoylphenyl)ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 95333326 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2E,4E)-N-methyl-N-[(1R)-1-(3-sulfamoylphenyl)ethyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)N(C)[C@H](C)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-4-5-6-10-15(18)17(3)12(2)13-8-7-9-14(11-13)21(16,19)20/h4-12H,1-3H3,(H2,16,19,20)/b5-4+,10-6+/t12-/m1/s1 |
| InChIKey | QLHUUZBOWKIXRU-VIGIRYAPSA-N |
| XLogP | 1.99 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|