C17H20FN3O5S2 — CID 56532417
2-fluoro-N-methyl-5-(methylsulfamoyl)-N-[1-(3-sulfamoylphenyl)ethyl]benzamide (PubChem CID 56532417) has the molecular formula C17H20FN3O5S2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-fluoro-N-methyl-5-(methylsulfamoyl)-N-[1-(3-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 2-fluoro-N-methyl-5-(methylsulfamoyl)-N-[1-(3-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 56532417 |
| Molecular Formula | C17H20FN3O5S2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-fluoro-N-methyl-5-(methylsulfamoyl)-N-[1-(3-sulfamoylphenyl)ethyl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)N(C)C(C)c2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C17H20FN3O5S2/c1-11(12-5-4-6-13(9-12)27(19,23)24)21(3)17(22)15-10-14(7-8-16(15)18)28(25,26)20-2/h4-11,20H,1-3H3,(H2,19,23,24) |
| InChIKey | NPNXLXRDRMMQBB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |