C24H25N3O5S — CID 166429332
2-hydroxy-N-methyl-N-[1-[3-[4-(methylcarbamoyl)phenyl]phenyl]ethyl]-5-sulfamoylbenzamide (PubChem CID 166429332) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is 2-hydroxy-N-methyl-N-[1-[3-[4-(methylcarbamoyl)phenyl]phenyl]ethyl]-5-sulfamoylbenzamide.
| Compound Name | 2-hydroxy-N-methyl-N-[1-[3-[4-(methylcarbamoyl)phenyl]phenyl]ethyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 166429332 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-hydroxy-N-methyl-N-[1-[3-[4-(methylcarbamoyl)phenyl]phenyl]ethyl]-5-sulfamoylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2cccc(C(C)N(C)C(=O)c3cc(S(N)(=O)=O)ccc3O)c2)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-15(27(3)24(30)21-14-20(33(25,31)32)11-12-22(21)28)18-5-4-6-19(13-18)16-7-9-17(10-8-16)23(29)26-2/h4-15,28H,1-3H3,(H,26,29)(H2,25,31,32) |
| InChIKey | QSNCLIFXMDAPHJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |