C23H25N3O5S2 — CID 41113907
N-methyl-3-[methyl(phenyl)sulfamoyl]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 41113907) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-methyl-3-[methyl(phenyl)sulfamoyl]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | N-methyl-3-[methyl(phenyl)sulfamoyl]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 41113907 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-methyl-3-[methyl(phenyl)sulfamoyl]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | C[C@H](c1ccc(S(N)(=O)=O)cc1)N(C)C(=O)c1cccc(S(=O)(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H25N3O5S2/c1-17(18-12-14-21(15-13-18)32(24,28)29)25(2)23(27)19-8-7-11-22(16-19)33(30,31)26(3)20-9-5-4-6-10-20/h4-17H,1-3H3,(H2,24,28,29)/t17-/m1/s1 |
| InChIKey | YPDQZQDJFXILKT-QGZVFWFLSA-N |
| XLogP | 2.99 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |