C16H17BrN2O3S — CID 34735400
3-bromo-N-methyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 34735400) has the molecular formula C16H17BrN2O3S and a molecular weight of 397.29 g/mol. Its IUPAC name is 3-bromo-N-methyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 3-bromo-N-methyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 34735400 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 3-bromo-N-methyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | C[C@H](c1ccc(S(N)(=O)=O)cc1)N(C)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H17BrN2O3S/c1-11(12-6-8-15(9-7-12)23(18,21)22)19(2)16(20)13-4-3-5-14(17)10-13/h3-11H,1-2H3,(H2,18,21,22)/t11-/m1/s1 |
| InChIKey | LTMVAVINKMLQAE-LLVKDONJSA-N |
| XLogP | 2.93 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |